C19H22O7 — CID 163018446
2-(7-oxo-2,3-dihydrofuro[3,2-g]chromen-2-yl)propan-2-yl 2,3-dihydroxy-2-methylbutanoate (PubChem CID 163018446) has the molecular formula C19H22O7 and a molecular weight of 362.38 g/mol. Its IUPAC name is 2-(7-oxo-2,3-dihydrofuro[3,2-g]chromen-2-yl)propan-2-yl 2,3-dihydroxy-2-methylbutanoate.
| Compound Name | 2-(7-oxo-2,3-dihydrofuro[3,2-g]chromen-2-yl)propan-2-yl 2,3-dihydroxy-2-methylbutanoate |
|---|---|
| PubChem CID | 163018446 |
| Molecular Formula | C19H22O7 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 2-(7-oxo-2,3-dihydrofuro[3,2-g]chromen-2-yl)propan-2-yl 2,3-dihydroxy-2-methylbutanoate |
| SMILES | CC(O)C(C)(O)C(=O)OC(C)(C)C1Cc2cc3ccc(=O)oc3cc2O1 |
| InChI | InChI=1S/C19H22O7/c1-10(20)19(4,23)17(22)26-18(2,3)15-8-12-7-11-5-6-16(21)25-13(11)9-14(12)24-15/h5-7,9-10,15,20,23H,8H2,1-4H3 |
| InChIKey | LOVRWVLOUWSIKS-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|