C16H16O5 — CID 24864690
(2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl) acetate (PubChem CID 24864690) has the molecular formula C16H16O5 and a molecular weight of 288.30 g/mol. Its IUPAC name is (2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl) acetate.
| Compound Name | (2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl) acetate |
|---|---|
| PubChem CID | 24864690 |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | (2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl) acetate |
| SMILES | CC(=O)OC1Cc2cc3ccc(=O)oc3cc2OC1(C)C |
| InChI | InChI=1S/C16H16O5/c1-9(17)19-14-7-11-6-10-4-5-15(18)20-12(10)8-13(11)21-16(14,2)3/h4-6,8,14H,7H2,1-3H3 |
| InChIKey | KPVAGSQSZBIVAD-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|