C23H20O8 — CID 142698592
[(3R)-2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl] 3-(3,4,5-trihydroxyphenyl)prop-2-enoate (PubChem CID 142698592) has the molecular formula C23H20O8 and a molecular weight of 424.41 g/mol. Its IUPAC name is [(3R)-2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl] 3-(3,4,5-trihydroxyphenyl)prop-2-enoate.
| Compound Name | [(3R)-2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl] 3-(3,4,5-trihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 142698592 |
| Molecular Formula | C23H20O8 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | [(3R)-2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl] 3-(3,4,5-trihydroxyphenyl)prop-2-enoate |
| SMILES | CC1(C)Oc2cc3oc(=O)ccc3cc2C[C@H]1OC(=O)C=Cc1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C23H20O8/c1-23(2)19(30-21(27)5-3-12-7-15(24)22(28)16(25)8-12)10-14-9-13-4-6-20(26)29-17(13)11-18(14)31-23/h3-9,11,19,24-25,28H,10H2,1-2H3/t19-/m1/s1 |
| InChIKey | MALCTRDCDMKDJD-LJQANCHMSA-N |
| XLogP | 3.25 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|