C18H20O4 — CID 45137417
(3R)-2,2-dimethyl-3-(2-methylprop-2-enoxy)-3,4-dihydropyrano[3,2-g]chromen-8-one (PubChem CID 45137417) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is (3R)-2,2-dimethyl-3-(2-methylprop-2-enoxy)-3,4-dihydropyrano[3,2-g]chromen-8-one.
| Compound Name | (3R)-2,2-dimethyl-3-(2-methylprop-2-enoxy)-3,4-dihydropyrano[3,2-g]chromen-8-one |
|---|---|
| PubChem CID | 45137417 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | (3R)-2,2-dimethyl-3-(2-methylprop-2-enoxy)-3,4-dihydropyrano[3,2-g]chromen-8-one |
| SMILES | C=C(C)CO[C@@H]1Cc2cc3ccc(=O)oc3cc2OC1(C)C |
| InChI | InChI=1S/C18H20O4/c1-11(2)10-20-16-8-13-7-12-5-6-17(19)21-14(12)9-15(13)22-18(16,3)4/h5-7,9,16H,1,8,10H2,2-4H3/t16-/m1/s1 |
| InChIKey | QWADDCGBTBCVTM-MRXNPFEDSA-N |
| XLogP | 3.47 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|