C24H26O5 — CID 46219067
(3S)-3-[3-(4-methoxyphenyl)propoxy]-2,2-dimethyl-3,4-dihydropyrano[3,2-g]chromen-8-one (PubChem CID 46219067) has the molecular formula C24H26O5 and a molecular weight of 394.47 g/mol. Its IUPAC name is (3S)-3-[3-(4-methoxyphenyl)propoxy]-2,2-dimethyl-3,4-dihydropyrano[3,2-g]chromen-8-one.
| Compound Name | (3S)-3-[3-(4-methoxyphenyl)propoxy]-2,2-dimethyl-3,4-dihydropyrano[3,2-g]chromen-8-one |
|---|---|
| PubChem CID | 46219067 |
| Molecular Formula | C24H26O5 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | (3S)-3-[3-(4-methoxyphenyl)propoxy]-2,2-dimethyl-3,4-dihydropyrano[3,2-g]chromen-8-one |
| SMILES | COc1ccc(CCCO[C@H]2Cc3cc4ccc(=O)oc4cc3OC2(C)C)cc1 |
| InChI | InChI=1S/C24H26O5/c1-24(2)22(27-12-4-5-16-6-9-19(26-3)10-7-16)14-18-13-17-8-11-23(25)28-20(17)15-21(18)29-24/h6-11,13,15,22H,4-5,12,14H2,1-3H3/t22-/m0/s1 |
| InChIKey | CPOSUMCBQDZJKZ-QFIPXVFZSA-N |
| XLogP | 4.53 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|