C19H20O6 — CID 72786169
(2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl) 4-hydroxy-3-methylbut-2-enoate (PubChem CID 72786169) has the molecular formula C19H20O6 and a molecular weight of 344.36 g/mol. Its IUPAC name is (2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl) 4-hydroxy-3-methylbut-2-enoate.
| Compound Name | (2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl) 4-hydroxy-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 72786169 |
| Molecular Formula | C19H20O6 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl) 4-hydroxy-3-methylbut-2-enoate |
| SMILES | CC(=CC(=O)OC1Cc2cc3ccc(=O)oc3cc2OC1(C)C)CO |
| InChI | InChI=1S/C19H20O6/c1-11(10-20)6-18(22)24-16-8-13-7-12-4-5-17(21)23-14(12)9-15(13)25-19(16,2)3/h4-7,9,16,20H,8,10H2,1-3H3 |
| InChIKey | ZANSSGQMUOIRJB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|