C24H22O6 — CID 142692170
(2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl) 3-(2-methoxyphenyl)prop-2-enoate (PubChem CID 142692170) has the molecular formula C24H22O6 and a molecular weight of 406.43 g/mol. Its IUPAC name is (2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl) 3-(2-methoxyphenyl)prop-2-enoate.
| Compound Name | (2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl) 3-(2-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 142692170 |
| Molecular Formula | C24H22O6 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | (2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl) 3-(2-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccccc1C=CC(=O)OC1Cc2cc3ccc(=O)oc3cc2OC1(C)C |
| InChI | InChI=1S/C24H22O6/c1-24(2)21(29-23(26)10-8-15-6-4-5-7-18(15)27-3)13-17-12-16-9-11-22(25)28-19(16)14-20(17)30-24/h4-12,14,21H,13H2,1-3H3 |
| InChIKey | RKWBOTPUCAVSAH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|