C22H25NO6 — CID 139472566
[(3R)-2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl] N-[(1E,3Z)-3-ethoxypenta-1,3-dienyl]carbamate (PubChem CID 139472566) has the molecular formula C22H25NO6 and a molecular weight of 399.44 g/mol. Its IUPAC name is [(3R)-2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl] N-[(1E,3Z)-3-ethoxypenta-1,3-dienyl]carbamate.
| Compound Name | [(3R)-2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl] N-[(1E,3Z)-3-ethoxypenta-1,3-dienyl]carbamate |
|---|---|
| PubChem CID | 139472566 |
| Molecular Formula | C22H25NO6 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | [(3R)-2,2-dimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl] N-[(1E,3Z)-3-ethoxypenta-1,3-dienyl]carbamate |
| SMILES | C/C=C(/C=C/NC(=O)O[C@@H]1Cc2cc3ccc(=O)oc3cc2OC1(C)C)OCC |
| InChI | InChI=1S/C22H25NO6/c1-5-16(26-6-2)9-10-23-21(25)28-19-12-15-11-14-7-8-20(24)27-17(14)13-18(15)29-22(19,3)4/h5,7-11,13,19H,6,12H2,1-4H3,(H,23,25)/b10-9+,16-5-/t19-/m1/s1 |
| InChIKey | YGYUUYYWHUELCF-KBLBQYDWSA-N |
| XLogP | 4.06 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|