C29H20O5 — CID 139232605
(2S,3S)-3-(4-methoxyphenyl)-2-(naphthalene-2-carbonyl)-2,3-dihydrofuro[3,2-c]chromen-4-one (PubChem CID 139232605) has the molecular formula C29H20O5 and a molecular weight of 448.47 g/mol. Its IUPAC name is (2S,3S)-3-(4-methoxyphenyl)-2-(naphthalene-2-carbonyl)-2,3-dihydrofuro[3,2-c]chromen-4-one.
| Compound Name | (2S,3S)-3-(4-methoxyphenyl)-2-(naphthalene-2-carbonyl)-2,3-dihydrofuro[3,2-c]chromen-4-one |
|---|---|
| PubChem CID | 139232605 |
| Molecular Formula | C29H20O5 |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | (2S,3S)-3-(4-methoxyphenyl)-2-(naphthalene-2-carbonyl)-2,3-dihydrofuro[3,2-c]chromen-4-one |
| SMILES | COc1ccc([C@H]2c3c(c4ccccc4oc3=O)O[C@@H]2C(=O)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C29H20O5/c1-32-21-14-12-18(13-15-21)24-25-27(22-8-4-5-9-23(22)33-29(25)31)34-28(24)26(30)20-11-10-17-6-2-3-7-19(17)16-20/h2-16,24,28H,1H3/t24-,28-/m0/s1 |
| InChIKey | LNGJRHSTDINMKA-CUBQBAPOSA-N |
| XLogP | 5.73 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|