C25H19NO5 — CID 97423987
(2R,3R)-N-(4-methoxyphenyl)-4-oxo-3-phenyl-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide (PubChem CID 97423987) has the molecular formula C25H19NO5 and a molecular weight of 413.43 g/mol. Its IUPAC name is (2R,3R)-N-(4-methoxyphenyl)-4-oxo-3-phenyl-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide.
| Compound Name | (2R,3R)-N-(4-methoxyphenyl)-4-oxo-3-phenyl-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide |
|---|---|
| PubChem CID | 97423987 |
| Molecular Formula | C25H19NO5 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | (2R,3R)-N-(4-methoxyphenyl)-4-oxo-3-phenyl-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide |
| SMILES | COc1ccc(NC(=O)[C@@H]2Oc3c(c(=O)oc4ccccc34)[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C25H19NO5/c1-29-17-13-11-16(12-14-17)26-24(27)23-20(15-7-3-2-4-8-15)21-22(31-23)18-9-5-6-10-19(18)30-25(21)28/h2-14,20,23H,1H3,(H,26,27)/t20-,23-/m1/s1 |
| InChIKey | ZHEGTJNLPZFPQJ-NFBKMPQASA-N |
| XLogP | 4.33 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|