C25H16F3NO5 — CID 97426759
(2R,3R)-N-(4-methoxyphenyl)-4-oxo-3-(2,3,4-trifluorophenyl)-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide (PubChem CID 97426759) has the molecular formula C25H16F3NO5 and a molecular weight of 467.40 g/mol. Its IUPAC name is (2R,3R)-N-(4-methoxyphenyl)-4-oxo-3-(2,3,4-trifluorophenyl)-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide.
| Compound Name | (2R,3R)-N-(4-methoxyphenyl)-4-oxo-3-(2,3,4-trifluorophenyl)-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide |
|---|---|
| PubChem CID | 97426759 |
| Molecular Formula | C25H16F3NO5 |
| Molecular Weight | 467.40 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | (2R,3R)-N-(4-methoxyphenyl)-4-oxo-3-(2,3,4-trifluorophenyl)-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide |
| SMILES | COc1ccc(NC(=O)[C@@H]2Oc3c(c(=O)oc4ccccc34)[C@@H]2c2ccc(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C25H16F3NO5/c1-32-13-8-6-12(7-9-13)29-24(30)23-18(15-10-11-16(26)21(28)20(15)27)19-22(34-23)14-4-2-3-5-17(14)33-25(19)31/h2-11,18,23H,1H3,(H,29,30)/t18-,23+/m0/s1 |
| InChIKey | GEDJMIWHYLCYIS-FDDCHVKYSA-N |
| XLogP | 4.75 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.40 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|