C28H21NO6 — CID 97423684
(2S,3R)-3-(2H-chromen-3-yl)-N-(4-methoxyphenyl)-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide (PubChem CID 97423684) has the molecular formula C28H21NO6 and a molecular weight of 467.48 g/mol. Its IUPAC name is (2S,3R)-3-(2H-chromen-3-yl)-N-(4-methoxyphenyl)-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide.
| Compound Name | (2S,3R)-3-(2H-chromen-3-yl)-N-(4-methoxyphenyl)-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide |
|---|---|
| PubChem CID | 97423684 |
| Molecular Formula | C28H21NO6 |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | (2S,3R)-3-(2H-chromen-3-yl)-N-(4-methoxyphenyl)-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide |
| SMILES | COc1ccc(NC(=O)[C@H]2Oc3c(c(=O)oc4ccccc34)[C@H]2C2=Cc3ccccc3OC2)cc1 |
| InChI | InChI=1S/C28H21NO6/c1-32-19-12-10-18(11-13-19)29-27(30)26-23(17-14-16-6-2-4-8-21(16)33-15-17)24-25(35-26)20-7-3-5-9-22(20)34-28(24)31/h2-14,23,26H,15H2,1H3,(H,29,30)/t23-,26+/m1/s1 |
| InChIKey | AHLDZYACDWJGJO-BVAGGSTKSA-N |
| XLogP | 4.76 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|