C27H23NO7 — CID 97424575
(2R,3R)-3-(2,4-dimethoxyphenyl)-N-(4-methoxyphenyl)-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide (PubChem CID 97424575) has the molecular formula C27H23NO7 and a molecular weight of 473.48 g/mol. Its IUPAC name is (2R,3R)-3-(2,4-dimethoxyphenyl)-N-(4-methoxyphenyl)-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide.
| Compound Name | (2R,3R)-3-(2,4-dimethoxyphenyl)-N-(4-methoxyphenyl)-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide |
|---|---|
| PubChem CID | 97424575 |
| Molecular Formula | C27H23NO7 |
| Molecular Weight | 473.48 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | (2R,3R)-3-(2,4-dimethoxyphenyl)-N-(4-methoxyphenyl)-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide |
| SMILES | COc1ccc(NC(=O)[C@@H]2Oc3c(c(=O)oc4ccccc34)[C@H]2c2ccc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C27H23NO7/c1-31-16-10-8-15(9-11-16)28-26(29)25-22(18-13-12-17(32-2)14-21(18)33-3)23-24(35-25)19-6-4-5-7-20(19)34-27(23)30/h4-14,22,25H,1-3H3,(H,28,29)/t22-,25-/m1/s1 |
| InChIKey | KCOOFAKNTJALDQ-RCZVLFRGSA-N |
| XLogP | 4.35 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.48 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|