C27H23NO8 — CID 71826114
3-(4-hydroxy-3,5-dimethoxyphenyl)-N-(3-methoxyphenyl)-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide (PubChem CID 71826114) has the molecular formula C27H23NO8 and a molecular weight of 489.48 g/mol. Its IUPAC name is 3-(4-hydroxy-3,5-dimethoxyphenyl)-N-(3-methoxyphenyl)-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide.
| Compound Name | 3-(4-hydroxy-3,5-dimethoxyphenyl)-N-(3-methoxyphenyl)-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide |
|---|---|
| PubChem CID | 71826114 |
| Molecular Formula | C27H23NO8 |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | 3-(4-hydroxy-3,5-dimethoxyphenyl)-N-(3-methoxyphenyl)-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide |
| SMILES | COc1cccc(NC(=O)C2Oc3c(c(=O)oc4ccccc34)C2c2cc(OC)c(O)c(OC)c2)c1 |
| InChI | InChI=1S/C27H23NO8/c1-32-16-8-6-7-15(13-16)28-26(30)25-21(14-11-19(33-2)23(29)20(12-14)34-3)22-24(36-25)17-9-4-5-10-18(17)35-27(22)31/h4-13,21,25,29H,1-3H3,(H,28,30) |
| InChIKey | AOTHYVSNRNGVRF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 116.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|