C30H27NO7 — CID 97424920
(2S,3S)-3-[3-methoxy-4-(2-methylprop-2-enoxy)phenyl]-N-(4-methoxyphenyl)-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide (PubChem CID 97424920) has the molecular formula C30H27NO7 and a molecular weight of 513.55 g/mol. Its IUPAC name is (2S,3S)-3-[3-methoxy-4-(2-methylprop-2-enoxy)phenyl]-N-(4-methoxyphenyl)-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide.
| Compound Name | (2S,3S)-3-[3-methoxy-4-(2-methylprop-2-enoxy)phenyl]-N-(4-methoxyphenyl)-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide |
|---|---|
| PubChem CID | 97424920 |
| Molecular Formula | C30H27NO7 |
| Molecular Weight | 513.55 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | (2S,3S)-3-[3-methoxy-4-(2-methylprop-2-enoxy)phenyl]-N-(4-methoxyphenyl)-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide |
| SMILES | C=C(C)COc1ccc([C@H]2c3c(c4ccccc4oc3=O)O[C@@H]2C(=O)Nc2ccc(OC)cc2)cc1OC |
| InChI | InChI=1S/C30H27NO7/c1-17(2)16-36-23-14-9-18(15-24(23)35-4)25-26-27(21-7-5-6-8-22(21)37-30(26)33)38-28(25)29(32)31-19-10-12-20(34-3)13-11-19/h5-15,25,28H,1,16H2,2-4H3,(H,31,32)/t25-,28-/m0/s1 |
| InChIKey | OTFAXMLNPJEHRH-LSYYVWMOSA-N |
| XLogP | 5.30 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.55 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|