C28H23NO5 — CID 97423872
(2R,3R)-3-[4-(2-methylprop-2-enoxy)phenyl]-4-oxo-N-phenyl-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide (PubChem CID 97423872) has the molecular formula C28H23NO5 and a molecular weight of 453.49 g/mol. Its IUPAC name is (2R,3R)-3-[4-(2-methylprop-2-enoxy)phenyl]-4-oxo-N-phenyl-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide.
| Compound Name | (2R,3R)-3-[4-(2-methylprop-2-enoxy)phenyl]-4-oxo-N-phenyl-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide |
|---|---|
| PubChem CID | 97423872 |
| Molecular Formula | C28H23NO5 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | (2R,3R)-3-[4-(2-methylprop-2-enoxy)phenyl]-4-oxo-N-phenyl-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide |
| SMILES | C=C(C)COc1ccc([C@@H]2c3c(c4ccccc4oc3=O)O[C@H]2C(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C28H23NO5/c1-17(2)16-32-20-14-12-18(13-15-20)23-24-25(21-10-6-7-11-22(21)33-28(24)31)34-26(23)27(30)29-19-8-4-3-5-9-19/h3-15,23,26H,1,16H2,2H3,(H,29,30)/t23-,26-/m1/s1 |
| InChIKey | CBOJHCKPDKKUQJ-ZEQKJWHPSA-N |
| XLogP | 5.28 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|