C25H17NO6 — CID 71827009
3-(1,3-benzodioxol-5-yl)-4-oxo-N-phenyl-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide (PubChem CID 71827009) has the molecular formula C25H17NO6 and a molecular weight of 427.41 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-4-oxo-N-phenyl-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-4-oxo-N-phenyl-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide |
|---|---|
| PubChem CID | 71827009 |
| Molecular Formula | C25H17NO6 |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-4-oxo-N-phenyl-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1Oc2c(c(=O)oc3ccccc23)C1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H17NO6/c27-24(26-15-6-2-1-3-7-15)23-20(14-10-11-18-19(12-14)30-13-29-18)21-22(32-23)16-8-4-5-9-17(16)31-25(21)28/h1-12,20,23H,13H2,(H,26,27) |
| InChIKey | DIPKETFSIRQTSN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|