C30H27NO11 — CID 98085575
(2S,3S)-3-(4,7-dimethoxy-1,3-benzodioxol-5-yl)-4-oxo-N-(3,4,5-trimethoxyphenyl)-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide (PubChem CID 98085575) has the molecular formula C30H27NO11 and a molecular weight of 577.54 g/mol. Its IUPAC name is (2S,3S)-3-(4,7-dimethoxy-1,3-benzodioxol-5-yl)-4-oxo-N-(3,4,5-trimethoxyphenyl)-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide.
| Compound Name | (2S,3S)-3-(4,7-dimethoxy-1,3-benzodioxol-5-yl)-4-oxo-N-(3,4,5-trimethoxyphenyl)-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide |
|---|---|
| PubChem CID | 98085575 |
| Molecular Formula | C30H27NO11 |
| Molecular Weight | 577.54 g/mol |
| Exact Mass | 577.16 |
| IUPAC Name | (2S,3S)-3-(4,7-dimethoxy-1,3-benzodioxol-5-yl)-4-oxo-N-(3,4,5-trimethoxyphenyl)-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide |
| SMILES | COc1cc(NC(=O)[C@H]2Oc3c(c(=O)oc4ccccc34)[C@@H]2c2cc(OC)c3c(c2OC)OCO3)cc(OC)c1OC |
| InChI | InChI=1S/C30H27NO11/c1-34-18-10-14(11-19(35-2)25(18)38-5)31-29(32)27-21(16-12-20(36-3)26-28(24(16)37-4)40-13-39-26)22-23(42-27)15-8-6-7-9-17(15)41-30(22)33/h6-12,21,27H,13H2,1-5H3,(H,31,32)/t21-,27-/m0/s1 |
| InChIKey | FZYOWMYFBBSEFH-IDISGSTGSA-N |
| XLogP | 4.10 |
| TPSA | 133.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.54 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|