C21H19NO4 — CID 97424848
(2R,3S)-4-oxo-N-phenyl-3-propan-2-yl-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide (PubChem CID 97424848) has the molecular formula C21H19NO4 and a molecular weight of 349.39 g/mol. Its IUPAC name is (2R,3S)-4-oxo-N-phenyl-3-propan-2-yl-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide.
| Compound Name | (2R,3S)-4-oxo-N-phenyl-3-propan-2-yl-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide |
|---|---|
| PubChem CID | 97424848 |
| Molecular Formula | C21H19NO4 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | (2R,3S)-4-oxo-N-phenyl-3-propan-2-yl-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide |
| SMILES | CC(C)[C@H]1c2c(c3ccccc3oc2=O)O[C@H]1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C21H19NO4/c1-12(2)16-17-18(14-10-6-7-11-15(14)25-21(17)24)26-19(16)20(23)22-13-8-4-3-5-9-13/h3-12,16,19H,1-2H3,(H,22,23)/t16-,19+/m0/s1 |
| InChIKey | SHHIFHSULVDDDY-QFBILLFUSA-N |
| XLogP | 3.93 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|