C19H18N2O5 — CID 97424099
(2R,3S)-N-(5-methyl-1,2-oxazol-3-yl)-4-oxo-3-propan-2-yl-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide (PubChem CID 97424099) has the molecular formula C19H18N2O5 and a molecular weight of 354.36 g/mol. Its IUPAC name is (2R,3S)-N-(5-methyl-1,2-oxazol-3-yl)-4-oxo-3-propan-2-yl-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide.
| Compound Name | (2R,3S)-N-(5-methyl-1,2-oxazol-3-yl)-4-oxo-3-propan-2-yl-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide |
|---|---|
| PubChem CID | 97424099 |
| Molecular Formula | C19H18N2O5 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | (2R,3S)-N-(5-methyl-1,2-oxazol-3-yl)-4-oxo-3-propan-2-yl-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide |
| SMILES | Cc1cc(NC(=O)[C@@H]2Oc3c(c(=O)oc4ccccc34)[C@@H]2C(C)C)no1 |
| InChI | InChI=1S/C19H18N2O5/c1-9(2)14-15-16(11-6-4-5-7-12(11)24-19(15)23)25-17(14)18(22)20-13-8-10(3)26-21-13/h4-9,14,17H,1-3H3,(H,20,21,22)/t14-,17+/m0/s1 |
| InChIKey | DDYUCXKIBMJYAG-WMLDXEAASA-N |
| XLogP | 3.23 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|