C24H20N2O8 — CID 97425258
(2S,3S)-3-(4-hydroxy-3,5-dimethoxyphenyl)-N-(5-methyl-1,2-oxazol-3-yl)-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide (PubChem CID 97425258) has the molecular formula C24H20N2O8 and a molecular weight of 464.43 g/mol. Its IUPAC name is (2S,3S)-3-(4-hydroxy-3,5-dimethoxyphenyl)-N-(5-methyl-1,2-oxazol-3-yl)-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide.
| Compound Name | (2S,3S)-3-(4-hydroxy-3,5-dimethoxyphenyl)-N-(5-methyl-1,2-oxazol-3-yl)-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide |
|---|---|
| PubChem CID | 97425258 |
| Molecular Formula | C24H20N2O8 |
| Molecular Weight | 464.43 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | (2S,3S)-3-(4-hydroxy-3,5-dimethoxyphenyl)-N-(5-methyl-1,2-oxazol-3-yl)-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxamide |
| SMILES | COc1cc([C@H]2c3c(c4ccccc4oc3=O)O[C@@H]2C(=O)Nc2cc(C)on2)cc(OC)c1O |
| InChI | InChI=1S/C24H20N2O8/c1-11-8-17(26-34-11)25-23(28)22-18(12-9-15(30-2)20(27)16(10-12)31-3)19-21(33-22)13-6-4-5-7-14(13)32-24(19)29/h4-10,18,22,27H,1-3H3,(H,25,26,28)/t18-,22-/m0/s1 |
| InChIKey | XJXJORCCHALKLT-AVRDEDQJSA-N |
| XLogP | 3.34 |
| TPSA | 133.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|