C29H25NO4 — CID 144970429
4,4-dimethyl-7'-(methylamino)-2'-phenylspiro[3H-pyrano[3,2-c]chromene-2,4'-chromene]-5-one (PubChem CID 144970429) has the molecular formula C29H25NO4 and a molecular weight of 451.52 g/mol. Its IUPAC name is 4,4-dimethyl-7'-(methylamino)-2'-phenylspiro[3H-pyrano[3,2-c]chromene-2,4'-chromene]-5-one.
| Compound Name | 4,4-dimethyl-7'-(methylamino)-2'-phenylspiro[3H-pyrano[3,2-c]chromene-2,4'-chromene]-5-one |
|---|---|
| PubChem CID | 144970429 |
| Molecular Formula | C29H25NO4 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | 4,4-dimethyl-7'-(methylamino)-2'-phenylspiro[3H-pyrano[3,2-c]chromene-2,4'-chromene]-5-one |
| SMILES | CNc1ccc2c(c1)OC(c1ccccc1)=CC21CC(C)(C)c2c(c3ccccc3oc2=O)O1 |
| InChI | InChI=1S/C29H25NO4/c1-28(2)17-29(34-26-20-11-7-8-12-22(20)33-27(31)25(26)28)16-24(18-9-5-4-6-10-18)32-23-15-19(30-3)13-14-21(23)29/h4-16,30H,17H2,1-3H3 |
| InChIKey | VTWRDCSMGCYGDK-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|