C15H14O5 — CID 100948123
(2,7-dimethyl-4-oxo-3H-furo[3,2-c]chromen-2-yl) acetate (PubChem CID 100948123) has the molecular formula C15H14O5 and a molecular weight of 274.27 g/mol. Its IUPAC name is (2,7-dimethyl-4-oxo-3H-furo[3,2-c]chromen-2-yl) acetate.
| Compound Name | (2,7-dimethyl-4-oxo-3H-furo[3,2-c]chromen-2-yl) acetate |
|---|---|
| PubChem CID | 100948123 |
| Molecular Formula | C15H14O5 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | (2,7-dimethyl-4-oxo-3H-furo[3,2-c]chromen-2-yl) acetate |
| SMILES | CC(=O)OC1(C)Cc2c(c3ccc(C)cc3oc2=O)O1 |
| InChI | InChI=1S/C15H14O5/c1-8-4-5-10-12(6-8)18-14(17)11-7-15(3,19-9(2)16)20-13(10)11/h4-6H,7H2,1-3H3 |
| InChIKey | JXUBECQYTUBQGA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|