C18H15ClO3 — CID 172638282
5-chloro-3,3-dimethyl-1,2-dihydropyrano[2,3-c]xanthen-7-one (PubChem CID 172638282) has the molecular formula C18H15ClO3 and a molecular weight of 314.77 g/mol. Its IUPAC name is 5-chloro-3,3-dimethyl-1,2-dihydropyrano[2,3-c]xanthen-7-one.
| Compound Name | 5-chloro-3,3-dimethyl-1,2-dihydropyrano[2,3-c]xanthen-7-one |
|---|---|
| PubChem CID | 172638282 |
| Molecular Formula | C18H15ClO3 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 5-chloro-3,3-dimethyl-1,2-dihydropyrano[2,3-c]xanthen-7-one |
| SMILES | CC1(C)CCc2c(c(Cl)cc3c(=O)c4ccccc4oc23)O1 |
| InChI | InChI=1S/C18H15ClO3/c1-18(2)8-7-11-16-12(9-13(19)17(11)22-18)15(20)10-5-3-4-6-14(10)21-16/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | ADENCDBVSZJJEZ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|