C18H15ClO4 — CID 71659231
8-chloro-12-hydroxy-2,2-dimethyl-3,4-dihydropyrano[3,2-b]xanthen-6-one (PubChem CID 71659231) has the molecular formula C18H15ClO4 and a molecular weight of 330.77 g/mol. Its IUPAC name is 8-chloro-12-hydroxy-2,2-dimethyl-3,4-dihydropyrano[3,2-b]xanthen-6-one.
| Compound Name | 8-chloro-12-hydroxy-2,2-dimethyl-3,4-dihydropyrano[3,2-b]xanthen-6-one |
|---|---|
| PubChem CID | 71659231 |
| Molecular Formula | C18H15ClO4 |
| Molecular Weight | 330.77 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 8-chloro-12-hydroxy-2,2-dimethyl-3,4-dihydropyrano[3,2-b]xanthen-6-one |
| SMILES | CC1(C)CCc2cc3c(=O)c4cc(Cl)ccc4oc3c(O)c2O1 |
| InChI | InChI=1S/C18H15ClO4/c1-18(2)6-5-9-7-12-14(20)11-8-10(19)3-4-13(11)22-17(12)15(21)16(9)23-18/h3-4,7-8,21H,5-6H2,1-2H3 |
| InChIKey | DDUWZQMDYIOMAA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.77 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|