C20H16O5 — CID 5318636
5-hydroxy-17,17-dimethyl-3,12,16-trioxapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(13),2(10),4(9),5,7,14,20-heptaen-11-one (PubChem CID 5318636) has the molecular formula C20H16O5 and a molecular weight of 336.34 g/mol. Its IUPAC name is 5-hydroxy-17,17-dimethyl-3,12,16-trioxapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(13),2(10),4(9),5,7,14,20-heptaen-11-one.
| Compound Name | 5-hydroxy-17,17-dimethyl-3,12,16-trioxapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(13),2(10),4(9),5,7,14,20-heptaen-11-one |
|---|---|
| PubChem CID | 5318636 |
| Molecular Formula | C20H16O5 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 5-hydroxy-17,17-dimethyl-3,12,16-trioxapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(13),2(10),4(9),5,7,14,20-heptaen-11-one |
| SMILES | CC1(C)CCc2cc3c(cc2O1)oc(=O)c1c2cccc(O)c2oc31 |
| InChI | InChI=1S/C20H16O5/c1-20(2)7-6-10-8-12-15(9-14(10)25-20)23-19(22)16-11-4-3-5-13(21)17(11)24-18(12)16/h3-5,8-9,21H,6-7H2,1-2H3 |
| InChIKey | IHQGOXPJZNAHOY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|