C29H32N2O7 — CID 40816680
4-[[(2S)-2-phenyl-2-[[2-(2,2,6-trimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-7-yl)acetyl]amino]acetyl]amino]butanoic acid (PubChem CID 40816680) has the molecular formula C29H32N2O7 and a molecular weight of 520.58 g/mol. Its IUPAC name is 4-[[(2S)-2-phenyl-2-[[2-(2,2,6-trimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-7-yl)acetyl]amino]acetyl]amino]butanoic acid.
| Compound Name | 4-[[(2S)-2-phenyl-2-[[2-(2,2,6-trimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-7-yl)acetyl]amino]acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 40816680 |
| Molecular Formula | C29H32N2O7 |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | 4-[[(2S)-2-phenyl-2-[[2-(2,2,6-trimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-7-yl)acetyl]amino]acetyl]amino]butanoic acid |
| SMILES | Cc1c(CC(=O)N[C@H](C(=O)NCCCC(=O)O)c2ccccc2)c(=O)oc2cc3c(cc12)CCC(C)(C)O3 |
| InChI | InChI=1S/C29H32N2O7/c1-17-20-14-19-11-12-29(2,3)38-22(19)16-23(20)37-28(36)21(17)15-24(32)31-26(18-8-5-4-6-9-18)27(35)30-13-7-10-25(33)34/h4-6,8-9,14,16,26H,7,10-13,15H2,1-3H3,(H,30,35)(H,31,32)(H,33,34)/t26-/m0/s1 |
| InChIKey | LPSBFCZNCAZFCI-SANMLTNESA-N |
| XLogP | 3.59 |
| TPSA | 134.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|