C26H29NO5 — CID 73257002
N-(1-hydroxy-3-phenylpropan-2-yl)-2-(2,2,6-trimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-7-yl)acetamide (PubChem CID 73257002) has the molecular formula C26H29NO5 and a molecular weight of 435.52 g/mol. Its IUPAC name is N-(1-hydroxy-3-phenylpropan-2-yl)-2-(2,2,6-trimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-7-yl)acetamide.
| Compound Name | N-(1-hydroxy-3-phenylpropan-2-yl)-2-(2,2,6-trimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-7-yl)acetamide |
|---|---|
| PubChem CID | 73257002 |
| Molecular Formula | C26H29NO5 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | N-(1-hydroxy-3-phenylpropan-2-yl)-2-(2,2,6-trimethyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-7-yl)acetamide |
| SMILES | Cc1c(CC(=O)NC(CO)Cc2ccccc2)c(=O)oc2cc3c(cc12)CCC(C)(C)O3 |
| InChI | InChI=1S/C26H29NO5/c1-16-20-12-18-9-10-26(2,3)32-22(18)14-23(20)31-25(30)21(16)13-24(29)27-19(15-28)11-17-7-5-4-6-8-17/h4-8,12,14,19,28H,9-11,13,15H2,1-3H3,(H,27,29) |
| InChIKey | AQEMPSBVBWLVFW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|