C27H38O5 — CID 134912097
1-(2,2-dimethyl-7-octyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-6-yl)propyl acetate (PubChem CID 134912097) has the molecular formula C27H38O5 and a molecular weight of 442.60 g/mol. Its IUPAC name is 1-(2,2-dimethyl-7-octyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-6-yl)propyl acetate.
| Compound Name | 1-(2,2-dimethyl-7-octyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-6-yl)propyl acetate |
|---|---|
| PubChem CID | 134912097 |
| Molecular Formula | C27H38O5 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | 1-(2,2-dimethyl-7-octyl-8-oxo-3,4-dihydropyrano[3,2-g]chromen-6-yl)propyl acetate |
| SMILES | CCCCCCCCc1c(C(CC)OC(C)=O)c2cc3c(cc2oc1=O)OC(C)(C)CC3 |
| InChI | InChI=1S/C27H38O5/c1-6-8-9-10-11-12-13-20-25(22(7-2)30-18(3)28)21-16-19-14-15-27(4,5)32-23(19)17-24(21)31-26(20)29/h16-17,22H,6-15H2,1-5H3 |
| InChIKey | GQEPBAOZINKTEW-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|