C12H16O3 — CID 10176661
7-methoxy-2,2-dimethyl-3,4-dihydrochromen-6-ol (PubChem CID 10176661) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is 7-methoxy-2,2-dimethyl-3,4-dihydrochromen-6-ol.
| Compound Name | 7-methoxy-2,2-dimethyl-3,4-dihydrochromen-6-ol |
|---|---|
| PubChem CID | 10176661 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 7-methoxy-2,2-dimethyl-3,4-dihydrochromen-6-ol |
| SMILES | COc1cc2c(cc1O)CCC(C)(C)O2 |
| InChI | InChI=1S/C12H16O3/c1-12(2)5-4-8-6-9(13)11(14-3)7-10(8)15-12/h6-7,13H,4-5H2,1-3H3 |
| InChIKey | JXPHIHWXMBYJAU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |