C18H22N2O2 — CID 71965539
(9,9-dimethyl-1,2,3,4,10,11-hexahydroisochromeno[4,3-g]chromen-5-ylidene)hydrazine (PubChem CID 71965539) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is (9,9-dimethyl-1,2,3,4,10,11-hexahydroisochromeno[4,3-g]chromen-5-ylidene)hydrazine.
| Compound Name | (9,9-dimethyl-1,2,3,4,10,11-hexahydroisochromeno[4,3-g]chromen-5-ylidene)hydrazine |
|---|---|
| PubChem CID | 71965539 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | (9,9-dimethyl-1,2,3,4,10,11-hexahydroisochromeno[4,3-g]chromen-5-ylidene)hydrazine |
| SMILES | CC1(C)CCc2cc3c4c(c(=NN)oc3cc2O1)CCCC4 |
| InChI | InChI=1S/C18H22N2O2/c1-18(2)8-7-11-9-14-12-5-3-4-6-13(12)17(20-19)21-16(14)10-15(11)22-18/h9-10H,3-8,19H2,1-2H3 |
| InChIKey | WZXAZWCTODXSBZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 60.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|