C11H15NO3S — CID 142779358
2,2-dimethyl-3,4-dihydrochromene-7-sulfonamide (PubChem CID 142779358) has the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. Its IUPAC name is 2,2-dimethyl-3,4-dihydrochromene-7-sulfonamide.
| Compound Name | 2,2-dimethyl-3,4-dihydrochromene-7-sulfonamide |
|---|---|
| PubChem CID | 142779358 |
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 2,2-dimethyl-3,4-dihydrochromene-7-sulfonamide |
| SMILES | CC1(C)CCc2ccc(S(N)(=O)=O)cc2O1 |
| InChI | InChI=1S/C11H15NO3S/c1-11(2)6-5-8-3-4-9(16(12,13)14)7-10(8)15-11/h3-4,7H,5-6H2,1-2H3,(H2,12,13,14) |
| InChIKey | ZJJMJVQNDVXSFD-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |