C14H20N2O4S — CID 95966784
2,2-dimethyl-4-(2-methylpropanoyl)-3H-1,4-benzoxazine-6-sulfonamide (PubChem CID 95966784) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is 2,2-dimethyl-4-(2-methylpropanoyl)-3H-1,4-benzoxazine-6-sulfonamide.
| Compound Name | 2,2-dimethyl-4-(2-methylpropanoyl)-3H-1,4-benzoxazine-6-sulfonamide |
|---|---|
| PubChem CID | 95966784 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 2,2-dimethyl-4-(2-methylpropanoyl)-3H-1,4-benzoxazine-6-sulfonamide |
| SMILES | CC(C)C(=O)N1CC(C)(C)Oc2ccc(S(N)(=O)=O)cc21 |
| InChI | InChI=1S/C14H20N2O4S/c1-9(2)13(17)16-8-14(3,4)20-12-6-5-10(7-11(12)16)21(15,18)19/h5-7,9H,8H2,1-4H3,(H2,15,18,19) |
| InChIKey | PTGJGYKOVVXZCI-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |