C25H35N3O3S — CID 53105717
N-[4-(diethylamino)-2-methylphenyl]-3,3-dimethyl-1-(2-methylpropanoyl)-2H-indole-5-sulfonamide (PubChem CID 53105717) has the molecular formula C25H35N3O3S and a molecular weight of 457.64 g/mol. Its IUPAC name is N-[4-(diethylamino)-2-methylphenyl]-3,3-dimethyl-1-(2-methylpropanoyl)-2H-indole-5-sulfonamide.
| Compound Name | N-[4-(diethylamino)-2-methylphenyl]-3,3-dimethyl-1-(2-methylpropanoyl)-2H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 53105717 |
| Molecular Formula | C25H35N3O3S |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | N-[4-(diethylamino)-2-methylphenyl]-3,3-dimethyl-1-(2-methylpropanoyl)-2H-indole-5-sulfonamide |
| SMILES | CCN(CC)c1ccc(NS(=O)(=O)c2ccc3c(c2)C(C)(C)CN3C(=O)C(C)C)c(C)c1 |
| InChI | InChI=1S/C25H35N3O3S/c1-8-27(9-2)19-10-12-22(18(5)14-19)26-32(30,31)20-11-13-23-21(15-20)25(6,7)16-28(23)24(29)17(3)4/h10-15,17,26H,8-9,16H2,1-7H3 |
| InChIKey | XPWQAFJDHCZYQV-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|