C20H24N2O3S — CID 53105534
1-acetyl-N-(2,6-dimethylphenyl)-3,3-dimethyl-2H-indole-5-sulfonamide (PubChem CID 53105534) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is 1-acetyl-N-(2,6-dimethylphenyl)-3,3-dimethyl-2H-indole-5-sulfonamide.
| Compound Name | 1-acetyl-N-(2,6-dimethylphenyl)-3,3-dimethyl-2H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 53105534 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 1-acetyl-N-(2,6-dimethylphenyl)-3,3-dimethyl-2H-indole-5-sulfonamide |
| SMILES | CC(=O)N1CC(C)(C)c2cc(S(=O)(=O)Nc3c(C)cccc3C)ccc21 |
| InChI | InChI=1S/C20H24N2O3S/c1-13-7-6-8-14(2)19(13)21-26(24,25)16-9-10-18-17(11-16)20(4,5)12-22(18)15(3)23/h6-11,21H,12H2,1-5H3 |
| InChIKey | QJSPKNNNRZZCIK-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |