C8H5F4NO4S — CID 124928506
2,2,3,3-tetrafluoro-1,4-benzodioxine-6-sulfonamide (PubChem CID 124928506) has the molecular formula C8H5F4NO4S and a molecular weight of 287.19 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-1,4-benzodioxine-6-sulfonamide.
| Compound Name | 2,2,3,3-tetrafluoro-1,4-benzodioxine-6-sulfonamide |
|---|---|
| PubChem CID | 124928506 |
| Molecular Formula | C8H5F4NO4S |
| Molecular Weight | 287.19 g/mol |
| Exact Mass | 286.99 |
| IUPAC Name | 2,2,3,3-tetrafluoro-1,4-benzodioxine-6-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)OC(F)(F)C(F)(F)O2 |
| InChI | InChI=1S/C8H5F4NO4S/c9-7(10)8(11,12)17-6-3-4(18(13,14)15)1-2-5(6)16-7/h1-3H,(H2,13,14,15) |
| InChIKey | ZFTVGVRPBMFKDX-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.19 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|