C10H5F4NO3 — CID 117411793
2,2,3,3-tetrafluoro-6-(isocyanatomethyl)-1,4-benzodioxine (PubChem CID 117411793) has the molecular formula C10H5F4NO3 and a molecular weight of 263.15 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-6-(isocyanatomethyl)-1,4-benzodioxine.
| Compound Name | 2,2,3,3-tetrafluoro-6-(isocyanatomethyl)-1,4-benzodioxine |
|---|---|
| PubChem CID | 117411793 |
| Molecular Formula | C10H5F4NO3 |
| Molecular Weight | 263.15 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | 2,2,3,3-tetrafluoro-6-(isocyanatomethyl)-1,4-benzodioxine |
| SMILES | O=C=NCc1ccc2c(c1)OC(F)(F)C(F)(F)O2 |
| InChI | InChI=1S/C10H5F4NO3/c11-9(12)10(13,14)18-8-3-6(4-15-5-16)1-2-7(8)17-9/h1-3H,4H2 |
| InChIKey | JZJOJKVGOGDTIH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.15 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|