About 5-(isocyanatomethyl)-N,N,2-trimethylaniline
5-(isocyanatomethyl)-N,N,2-trimethylaniline (PubChem CID 117114769) has the molecular formula C11H14N2O
and a molecular weight of 190.25 g/mol. Its IUPAC name is 5-(isocyanatomethyl)-N,N,2-trimethylaniline.
Molecular Properties
| Compound Name | 5-(isocyanatomethyl)-N,N,2-trimethylaniline |
| PubChem CID | 117114769 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 5-(isocyanatomethyl)-N,N,2-trimethylaniline |
| SMILES | Cc1ccc(CN=C=O)cc1N(C)C |
| InChI | InChI=1S/C11H14N2O/c1-9-4-5-10(7-12-8-14)6-11(9)13(2)3/h4-6H,7H2,1-3H3 |
| InChIKey | KGUBSQMDWRTWLA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 5-(isocyanatomethyl)-N,N,2-trimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(isocyanatomethyl)-N,N,2-trimethylaniline?
The IUPAC name of 5-(isocyanatomethyl)-N,N,2-trimethylaniline (CID 117114769) is 5-(isocyanatomethyl)-N,N,2-trimethylaniline.
What is the SMILES notation for 5-(isocyanatomethyl)-N,N,2-trimethylaniline?
The canonical SMILES for 5-(isocyanatomethyl)-N,N,2-trimethylaniline is Cc1ccc(CN=C=O)cc1N(C)C.
What is the InChIKey of 5-(isocyanatomethyl)-N,N,2-trimethylaniline?
The InChIKey is KGUBSQMDWRTWLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O/c1-9-4-5-10(7-12-8-14)6-11(9)13(2)3/h4-6H,7H2,1-3H3.
What are the key properties of 5-(isocyanatomethyl)-N,N,2-trimethylaniline?
5-(isocyanatomethyl)-N,N,2-trimethylaniline has a molecular weight of 190.25 g/mol, XLogP of 1.90, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(isocyanatomethyl)-N,N,2-trimethylaniline is sourced from PubChem (CID 117114769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).