C11H14N2O — CID 117114769
5-(isocyanatomethyl)-N,N,2-trimethylaniline (PubChem CID 117114769) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 5-(isocyanatomethyl)-N,N,2-trimethylaniline.
| Compound Name | 5-(isocyanatomethyl)-N,N,2-trimethylaniline |
|---|---|
| PubChem CID | 117114769 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 5-(isocyanatomethyl)-N,N,2-trimethylaniline |
| SMILES | Cc1ccc(CN=C=O)cc1N(C)C |
| InChI | InChI=1S/C11H14N2O/c1-9-4-5-10(7-12-8-14)6-11(9)13(2)3/h4-6H,7H2,1-3H3 |
| InChIKey | KGUBSQMDWRTWLA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|