C9H14N2 — CID 838511
3-N,3-N,4-trimethylbenzene-1,3-diamine (PubChem CID 838511) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 3-N,3-N,4-trimethylbenzene-1,3-diamine.
| Compound Name | 3-N,3-N,4-trimethylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 838511 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 3-N,3-N,4-trimethylbenzene-1,3-diamine |
| SMILES | Cc1ccc(N)cc1N(C)C |
| InChI | InChI=1S/C9H14N2/c1-7-4-5-8(10)6-9(7)11(2)3/h4-6H,10H2,1-3H3 |
| InChIKey | BZFRCCRHMACPGO-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|