C14H17N3 — CID 19009144
4-(4-aminophenyl)-3-N,3-N-dimethylbenzene-1,3-diamine (PubChem CID 19009144) has the molecular formula C14H17N3 and a molecular weight of 227.31 g/mol. Its IUPAC name is 4-(4-aminophenyl)-3-N,3-N-dimethylbenzene-1,3-diamine.
| Compound Name | 4-(4-aminophenyl)-3-N,3-N-dimethylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 19009144 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 4-(4-aminophenyl)-3-N,3-N-dimethylbenzene-1,3-diamine |
| SMILES | CN(C)c1cc(N)ccc1-c1ccc(N)cc1 |
| InChI | InChI=1S/C14H17N3/c1-17(2)14-9-12(16)7-8-13(14)10-3-5-11(15)6-4-10/h3-9H,15-16H2,1-2H3 |
| InChIKey | IKNNYPVFDPOCIZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|