C16H21ClN2 — CID 11579985
4-(4-aminophenyl)-N,N,2,3-tetramethylaniline;hydrochloride (PubChem CID 11579985) has the molecular formula C16H21ClN2 and a molecular weight of 276.81 g/mol. Its IUPAC name is 4-(4-aminophenyl)-N,N,2,3-tetramethylaniline;hydrochloride.
| Compound Name | 4-(4-aminophenyl)-N,N,2,3-tetramethylaniline;hydrochloride |
|---|---|
| PubChem CID | 11579985 |
| Molecular Formula | C16H21ClN2 |
| Molecular Weight | 276.81 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 4-(4-aminophenyl)-N,N,2,3-tetramethylaniline;hydrochloride |
| SMILES | Cc1c(-c2ccc(N)cc2)ccc(N(C)C)c1C.Cl |
| InChI | InChI=1S/C16H20N2.ClH/c1-11-12(2)16(18(3)4)10-9-15(11)13-5-7-14(17)8-6-13;/h5-10H,17H2,1-4H3;1H |
| InChIKey | ZYSNFLGNECWXEK-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.81 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|