C36H32N6 — CID 67826937
4-N-(4-aminophenyl)-4-N-[2,3,4-tris(4-aminophenyl)phenyl]benzene-1,4-diamine (PubChem CID 67826937) has the molecular formula C36H32N6 and a molecular weight of 548.69 g/mol. Its IUPAC name is 4-N-(4-aminophenyl)-4-N-[2,3,4-tris(4-aminophenyl)phenyl]benzene-1,4-diamine.
| Compound Name | 4-N-(4-aminophenyl)-4-N-[2,3,4-tris(4-aminophenyl)phenyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 67826937 |
| Molecular Formula | C36H32N6 |
| Molecular Weight | 548.69 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | 4-N-(4-aminophenyl)-4-N-[2,3,4-tris(4-aminophenyl)phenyl]benzene-1,4-diamine |
| SMILES | Nc1ccc(-c2ccc(N(c3ccc(N)cc3)c3ccc(N)cc3)c(-c3ccc(N)cc3)c2-c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C36H32N6/c37-26-7-1-23(2-8-26)33-21-22-34(42(31-17-13-29(40)14-18-31)32-19-15-30(41)16-20-32)36(25-5-11-28(39)12-6-25)35(33)24-3-9-27(38)10-4-24/h1-22H,37-41H2 |
| InChIKey | FAJGKWGXYYFCCZ-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 133.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.69 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|