C33H24N4 — CID 175865200
N,N-diphenyl-2,3,4-tripyridin-4-ylaniline (PubChem CID 175865200) has the molecular formula C33H24N4 and a molecular weight of 476.58 g/mol. Its IUPAC name is N,N-diphenyl-2,3,4-tripyridin-4-ylaniline.
| Compound Name | N,N-diphenyl-2,3,4-tripyridin-4-ylaniline |
|---|---|
| PubChem CID | 175865200 |
| Molecular Formula | C33H24N4 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | N,N-diphenyl-2,3,4-tripyridin-4-ylaniline |
| SMILES | c1ccc(N(c2ccccc2)c2ccc(-c3ccncc3)c(-c3ccncc3)c2-c2ccncc2)cc1 |
| InChI | InChI=1S/C33H24N4/c1-3-7-28(8-4-1)37(29-9-5-2-6-10-29)31-12-11-30(25-13-19-34-20-14-25)32(26-15-21-35-22-16-26)33(31)27-17-23-36-24-18-27/h1-24H |
| InChIKey | WMRYTJSYXQWWFC-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |