C30H22Cl2N2 — CID 155431854
2,5-dichloro-1-N,1-N,3-N,3-N-tetraphenylbenzene-1,3-diamine (PubChem CID 155431854) has the molecular formula C30H22Cl2N2 and a molecular weight of 481.43 g/mol. Its IUPAC name is 2,5-dichloro-1-N,1-N,3-N,3-N-tetraphenylbenzene-1,3-diamine.
| Compound Name | 2,5-dichloro-1-N,1-N,3-N,3-N-tetraphenylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 155431854 |
| Molecular Formula | C30H22Cl2N2 |
| Molecular Weight | 481.43 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | 2,5-dichloro-1-N,1-N,3-N,3-N-tetraphenylbenzene-1,3-diamine |
| SMILES | Clc1cc(N(c2ccccc2)c2ccccc2)c(Cl)c(N(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C30H22Cl2N2/c31-23-21-28(33(24-13-5-1-6-14-24)25-15-7-2-8-16-25)30(32)29(22-23)34(26-17-9-3-10-18-26)27-19-11-4-12-20-27/h1-22H |
| InChIKey | CLEORFRHMCEKRA-UHFFFAOYSA-N |
| XLogP | 9.93 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.43 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |