C58H64ClN3 — CID 162494576
1-N,3-N-bis(4-tert-butylphenyl)-1-N,3-N-bis(4-tert-butyl-2,3,5,6-tetradeuteriophenyl)-2-chloro-5-N,5-N-diphenylbenzene-1,3,5-triamine (PubChem CID 162494576) has the molecular formula C58H64ClN3 and a molecular weight of 846.67 g/mol. Its IUPAC name is 1-N,3-N-bis(4-tert-butylphenyl)-1-N,3-N-bis(4-tert-butyl-2,3,5,6-tetradeuteriophenyl)-2-chloro-5-N,5-N-diphenylbenzene-1,3,5-triamine.
| Compound Name | 1-N,3-N-bis(4-tert-butylphenyl)-1-N,3-N-bis(4-tert-butyl-2,3,5,6-tetradeuteriophenyl)-2-chloro-5-N,5-N-diphenylbenzene-1,3,5-triamine |
|---|---|
| PubChem CID | 162494576 |
| Molecular Formula | C58H64ClN3 |
| Molecular Weight | 846.67 g/mol |
| Exact Mass | 845.53 |
| IUPAC Name | 1-N,3-N-bis(4-tert-butylphenyl)-1-N,3-N-bis(4-tert-butyl-2,3,5,6-tetradeuteriophenyl)-2-chloro-5-N,5-N-diphenylbenzene-1,3,5-triamine |
| SMILES | [2H]c1c([2H])c(C(C)(C)C)c([2H])c([2H])c1N(c1ccc(C(C)(C)C)cc1)c1cc(N(c2ccccc2)c2ccccc2)cc(N(c2ccc(C(C)(C)C)cc2)c2c([2H])c([2H])c(C(C)(C)C)c([2H])c2[2H])c1Cl |
| InChI | InChI=1S/C58H64ClN3/c1-55(2,3)41-23-31-47(32-24-41)61(48-33-25-42(26-34-48)56(4,5)6)52-39-51(60(45-19-15-13-16-20-45)46-21-17-14-18-22-46)40-53(54(52)59)62(49-35-27-43(28-36-49)57(7,8)9)50-37-29-44(30-38-50)58(10,11)12/h13-40H,1-12H3/i23D,24D,27D,28D,31D,32D,35D,36D |
| InChIKey | QJJWNFISAAASEV-DMGONXQESA-N |
| XLogP | 17.94 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.67 |
| LogP ≤ 5 | 17.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |