C75H71ClN4 — CID 176626904
1-N,1-N,3-N-tris(4-tert-butylphenyl)-3-N-(1-carbazol-9-yl-9,9-dimethylfluoren-4-yl)-2-chloro-5-N,5-N-diphenylbenzene-1,3,5-triamine (PubChem CID 176626904) has the molecular formula C75H71ClN4 and a molecular weight of 1063.87 g/mol. Its IUPAC name is 1-N,1-N,3-N-tris(4-tert-butylphenyl)-3-N-(1-carbazol-9-yl-9,9-dimethylfluoren-4-yl)-2-chloro-5-N,5-N-diphenylbenzene-1,3,5-triamine.
| Compound Name | 1-N,1-N,3-N-tris(4-tert-butylphenyl)-3-N-(1-carbazol-9-yl-9,9-dimethylfluoren-4-yl)-2-chloro-5-N,5-N-diphenylbenzene-1,3,5-triamine |
|---|---|
| PubChem CID | 176626904 |
| Molecular Formula | C75H71ClN4 |
| Molecular Weight | 1063.87 g/mol |
| Exact Mass | 1062.54 |
| IUPAC Name | 1-N,1-N,3-N-tris(4-tert-butylphenyl)-3-N-(1-carbazol-9-yl-9,9-dimethylfluoren-4-yl)-2-chloro-5-N,5-N-diphenylbenzene-1,3,5-triamine |
| SMILES | CC(C)(C)c1ccc(N(c2ccc(C(C)(C)C)cc2)c2cc(N(c3ccccc3)c3ccccc3)cc(N(c3ccc(C(C)(C)C)cc3)c3ccc(-n4c5ccccc5c5ccccc54)c4c3-c3ccccc3C4(C)C)c2Cl)cc1 |
| InChI | InChI=1S/C75H71ClN4/c1-72(2,3)50-34-40-55(41-35-50)78(56-42-36-51(37-43-56)73(4,5)6)67-48-58(77(53-24-14-12-15-25-53)54-26-16-13-17-27-54)49-68(71(67)76)79(57-44-38-52(39-45-57)74(7,8)9)65-46-47-66(70-69(65)61-30-18-21-31-62(61)75(70,10)11)80-63-32-22-19-28-59(63)60-29-20-23-33-64(60)80/h12-49H,1-11H3 |
| InChIKey | CRLGTFGDHYNYKC-UHFFFAOYSA-N |
| XLogP | 22.05 |
| TPSA | 14.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1063.87 |
| LogP ≤ 5 | 22.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |