C58H54N2 — CID 167415283
6-carbazol-9-yl-N-[3,5-ditert-butyl-4-(4-tert-butylphenyl)phenyl]-N-phenylpyren-1-amine (PubChem CID 167415283) has the molecular formula C58H54N2 and a molecular weight of 779.08 g/mol. Its IUPAC name is 6-carbazol-9-yl-N-[3,5-ditert-butyl-4-(4-tert-butylphenyl)phenyl]-N-phenylpyren-1-amine.
| Compound Name | 6-carbazol-9-yl-N-[3,5-ditert-butyl-4-(4-tert-butylphenyl)phenyl]-N-phenylpyren-1-amine |
|---|---|
| PubChem CID | 167415283 |
| Molecular Formula | C58H54N2 |
| Molecular Weight | 779.08 g/mol |
| Exact Mass | 778.43 |
| IUPAC Name | 6-carbazol-9-yl-N-[3,5-ditert-butyl-4-(4-tert-butylphenyl)phenyl]-N-phenylpyren-1-amine |
| SMILES | CC(C)(C)c1ccc(-c2c(C(C)(C)C)cc(N(c3ccccc3)c3ccc4ccc5c(-n6c7ccccc7c7ccccc76)ccc6ccc3c4c65)cc2C(C)(C)C)cc1 |
| InChI | InChI=1S/C58H54N2/c1-56(2,3)40-29-23-39(24-30-40)55-47(57(4,5)6)35-42(36-48(55)58(7,8)9)59(41-17-11-10-12-18-41)51-33-27-37-26-32-46-52(34-28-38-25-31-45(51)53(37)54(38)46)60-49-21-15-13-19-43(49)44-20-14-16-22-50(44)60/h10-36H,1-9H3 |
| InChIKey | RKDDHRSOKMPQRR-UHFFFAOYSA-N |
| XLogP | 16.71 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.08 |
| LogP ≤ 5 | 16.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|