C74H86N2 — CID 167415563
N-(4-tert-butylphenyl)-6-(3,6-ditert-butylcarbazol-9-yl)-N-[3,5-ditert-butyl-4-(3,5-ditert-butylphenyl)phenyl]pyren-1-amine (PubChem CID 167415563) has the molecular formula C74H86N2 and a molecular weight of 1003.52 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-6-(3,6-ditert-butylcarbazol-9-yl)-N-[3,5-ditert-butyl-4-(3,5-ditert-butylphenyl)phenyl]pyren-1-amine.
| Compound Name | N-(4-tert-butylphenyl)-6-(3,6-ditert-butylcarbazol-9-yl)-N-[3,5-ditert-butyl-4-(3,5-ditert-butylphenyl)phenyl]pyren-1-amine |
|---|---|
| PubChem CID | 167415563 |
| Molecular Formula | C74H86N2 |
| Molecular Weight | 1003.52 g/mol |
| Exact Mass | 1002.68 |
| IUPAC Name | N-(4-tert-butylphenyl)-6-(3,6-ditert-butylcarbazol-9-yl)-N-[3,5-ditert-butyl-4-(3,5-ditert-butylphenyl)phenyl]pyren-1-amine |
| SMILES | CC(C)(C)c1ccc(N(c2cc(C(C)(C)C)c(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)c(C(C)(C)C)c2)c2ccc3ccc4c(-n5c6ccc(C(C)(C)C)cc6c6cc(C(C)(C)C)ccc65)ccc5ccc2c3c54)cc1 |
| InChI | InChI=1S/C74H86N2/c1-68(2,3)48-26-30-53(31-27-48)75(54-43-59(73(16,17)18)67(60(44-54)74(19,20)21)47-38-51(71(10,11)12)40-52(39-47)72(13,14)15)61-34-24-45-23-33-56-62(35-25-46-22-32-55(61)65(45)66(46)56)76-63-36-28-49(69(4,5)6)41-57(63)58-42-50(70(7,8)9)29-37-64(58)76/h22-44H,1-21H3 |
| InChIKey | UWIGYSHQXXCAJA-UHFFFAOYSA-N |
| XLogP | 21.90 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1003.52 |
| LogP ≤ 5 | 21.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|