C74H86N2 — CID 167415646
N-[4-tert-butyl-3-(3,5-ditert-butylphenyl)phenyl]-6-(3,6-ditert-butylcarbazol-9-yl)-N-(3,5-ditert-butylphenyl)pyren-1-amine (PubChem CID 167415646) has the molecular formula C74H86N2 and a molecular weight of 1003.52 g/mol. Its IUPAC name is N-[4-tert-butyl-3-(3,5-ditert-butylphenyl)phenyl]-6-(3,6-ditert-butylcarbazol-9-yl)-N-(3,5-ditert-butylphenyl)pyren-1-amine.
| Compound Name | N-[4-tert-butyl-3-(3,5-ditert-butylphenyl)phenyl]-6-(3,6-ditert-butylcarbazol-9-yl)-N-(3,5-ditert-butylphenyl)pyren-1-amine |
|---|---|
| PubChem CID | 167415646 |
| Molecular Formula | C74H86N2 |
| Molecular Weight | 1003.52 g/mol |
| Exact Mass | 1002.68 |
| IUPAC Name | N-[4-tert-butyl-3-(3,5-ditert-butylphenyl)phenyl]-6-(3,6-ditert-butylcarbazol-9-yl)-N-(3,5-ditert-butylphenyl)pyren-1-amine |
| SMILES | CC(C)(C)c1cc(-c2cc(N(c3cc(C(C)(C)C)cc(C(C)(C)C)c3)c3ccc4ccc5c(-n6c7ccc(C(C)(C)C)cc7c7cc(C(C)(C)C)ccc76)ccc6ccc3c4c65)ccc2C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C74H86N2/c1-68(2,3)48-26-34-64-59(42-48)60-43-49(69(4,5)6)27-35-65(60)76(64)63-33-25-46-22-29-56-62(32-24-45-23-30-57(63)67(46)66(45)56)75(55-40-52(72(13,14)15)39-53(41-55)73(16,17)18)54-28-31-61(74(19,20)21)58(44-54)47-36-50(70(7,8)9)38-51(37-47)71(10,11)12/h22-44H,1-21H3 |
| InChIKey | BYYOALSICREVFJ-UHFFFAOYSA-N |
| XLogP | 21.90 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1003.52 |
| LogP ≤ 5 | 21.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|