C70H78N2 — CID 167415497
6-carbazol-9-yl-N-[2,5-ditert-butyl-4-(3,5-ditert-butylphenyl)phenyl]-N-(3,5-ditert-butylphenyl)pyren-1-amine (PubChem CID 167415497) has the molecular formula C70H78N2 and a molecular weight of 947.41 g/mol. Its IUPAC name is 6-carbazol-9-yl-N-[2,5-ditert-butyl-4-(3,5-ditert-butylphenyl)phenyl]-N-(3,5-ditert-butylphenyl)pyren-1-amine.
| Compound Name | 6-carbazol-9-yl-N-[2,5-ditert-butyl-4-(3,5-ditert-butylphenyl)phenyl]-N-(3,5-ditert-butylphenyl)pyren-1-amine |
|---|---|
| PubChem CID | 167415497 |
| Molecular Formula | C70H78N2 |
| Molecular Weight | 947.41 g/mol |
| Exact Mass | 946.62 |
| IUPAC Name | 6-carbazol-9-yl-N-[2,5-ditert-butyl-4-(3,5-ditert-butylphenyl)phenyl]-N-(3,5-ditert-butylphenyl)pyren-1-amine |
| SMILES | CC(C)(C)c1cc(-c2cc(C(C)(C)C)c(N(c3cc(C(C)(C)C)cc(C(C)(C)C)c3)c3ccc4ccc5c(-n6c7ccccc7c7ccccc76)ccc6ccc3c4c65)cc2C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C70H78N2/c1-65(2,3)46-35-45(36-47(37-46)66(4,5)6)55-41-57(70(16,17)18)62(42-56(55)69(13,14)15)71(50-39-48(67(7,8)9)38-49(40-50)68(10,11)12)60-33-29-43-28-32-54-61(34-30-44-27-31-53(60)63(43)64(44)54)72-58-25-21-19-23-51(58)52-24-20-22-26-59(52)72/h19-42H,1-18H3 |
| InChIKey | JIJKXDLMSALPPK-UHFFFAOYSA-N |
| XLogP | 20.60 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 947.41 |
| LogP ≤ 5 | 20.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|